CAS 889944-24-5
:4-methoxy-1H-indole-3-carboxamidine
Description:
4-Methoxy-1H-indole-3-carboxamidine is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a methoxy group (-OCH3) at the 4-position and a carboxamidine functional group (-C(=NH)NH2) at the 3-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the methoxy and carboxamidine groups. It may also display biological activity, making it of interest in medicinal chemistry and pharmacology. The compound's molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature. As with many organic compounds, proper handling and safety precautions are essential when working with 4-methoxy-1H-indole-3-carboxamidine in laboratory settings.
Formula:C10H11N3O
InChI:InChI=1/C10H11N3O/c1-14-8-4-2-3-7-9(8)6(5-13-7)10(11)12/h2-5,13H,1H3,(H3,11,12)
SMILES:COc1cccc2c1c(c[nH]2)C(=N)N
Synonyms:- 1H-indole-3-carboximidamide, 4-methoxy-
- 4-methoxy-1H-Indole-3-carboximidamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
