CymitQuimica logo

CAS 889944-87-0

:

3-(2-Benzothiazolyl)benzenemethanol

Description:
3-(2-Benzothiazolyl)benzenemethanol is an organic compound characterized by its complex structure, which includes a benzothiazole moiety and a benzenemethanol group. The presence of the benzothiazole ring contributes to its potential biological activity, as this heterocyclic structure is often associated with various pharmacological properties. The compound typically exhibits moderate solubility in organic solvents, and its chemical behavior can be influenced by the hydroxyl (-OH) group attached to the benzenemethanol part, which can participate in hydrogen bonding and affect its reactivity. Additionally, the compound may display fluorescence properties due to the conjugated system formed by the aromatic rings, making it of interest in materials science and biological applications. Its molecular interactions and stability can be influenced by factors such as pH and solvent polarity. Overall, 3-(2-Benzothiazolyl)benzenemethanol is a compound of interest in both synthetic chemistry and potential medicinal applications, warranting further investigation into its properties and uses.
Formula:C14H11NOS
InChI:InChI=1S/C14H11NOS/c16-9-10-4-3-5-11(8-10)14-15-12-6-1-2-7-13(12)17-14/h1-8,16H,9H2
InChI key:InChIKey=BFQMHOGCJRXLNF-UHFFFAOYSA-N
SMILES:C(O)C=1C=C(C2=NC=3C(S2)=CC=CC3)C=CC1
Synonyms:
  • 3-(2-Benzothiazolyl)benzenemethanol
  • Benzenemethanol, 3-(2-benzothiazolyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.