CAS 889945-01-1

1-(2-aminoethyl)-4,6-dimethylpyrimidin-2(1H)-one

Description:

1-(2-aminoethyl)-4,6-dimethylpyrimidin-2(1H)-one, with the CAS number 889945-01-1, is a pyrimidine derivative characterized by its unique structural features. This compound contains a pyrimidine ring substituted with two methyl groups at the 4 and 6 positions and an aminoethyl group at the 1 position. The presence of the amino group contributes to its potential as a biological active molecule, possibly influencing its solubility and reactivity. The compound is likely to exhibit polar characteristics due to the amino group, which can engage in hydrogen bonding. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. Additionally, the presence of the dimethyl and aminoethyl substituents may enhance its interaction with biological targets, making it a candidate for further research in medicinal chemistry. Overall, this compound's unique features position it as an interesting subject for studies in both synthetic and medicinal chemistry.

Formula: C₈H₁₃N₃O

InChI: InChI=1/C8H13N3O/c1-6-5-7(2)11(4-3-9)8(12)10-6/h5H,3-4,9H2,1-2H3

SMILES: Cc1cc(C)n(CCN)c(=O)n1

Synonyms:

• 2(1H)-pyrimidinone, 1-(2-aminoethyl)-4,6-dimethyl-