CAS 889945-79-3

4-Chloroimidazo[2,1-f][1,2,4]triazine

Description:

4-Chloroimidazo[2,1-f][1,2,4]triazine is a heterocyclic compound characterized by its fused imidazole and triazine rings, which contribute to its unique chemical properties. The presence of a chlorine atom at the 4-position enhances its reactivity and solubility in various organic solvents. This compound typically exhibits a pale yellow to off-white solid appearance and has a relatively high melting point, indicative of strong intermolecular interactions. It is known for its potential applications in medicinal chemistry, particularly as a scaffold for developing bioactive compounds, including antimicrobial and anticancer agents. The structure allows for various substitution reactions, making it versatile in synthetic chemistry. Additionally, its stability under standard laboratory conditions makes it suitable for further chemical modifications. As with many heterocycles, it may exhibit interesting electronic properties, which can be exploited in materials science and organic electronics. Safety precautions should be taken when handling this compound, as it may pose health risks due to its chlorine content and potential biological activity.

Formula: C₅H₃ClN₄

InChI: InChI=1/C5H3ClN4/c6-4-5-7-1-2-10(5)9-3-8-4/h1-3H

SMILES: c1cn2c(c(Cl)ncn2)n1

Synonyms:

• Imidazo[2,1-F][1,2,4]Triazine, 4-Chloro-
• 4-Chloropyrrolo[1,2-F][1,2,4]Triazine
• 4-Chloropyrrolo[2,1-F][1,2,4]Triazine
• 4-Chloroimidazo[4,3-F][1,2,4]Triazine

4-Chloroimidazo[5,1-f][1,2,4]triazine

CAS: 889945-79-3

Formula: C₅H₃ClN₄

Molecular weight: 154.5571

Ref: IN-DA00IFJC

4-Chloroimidazo[5,1-f][1,2,4]triazine

CAS: 889945-79-3

4-Chloroimidazo[5,1-f][1,2,4]triazine

Purity: 95%

Molecular weight: 154.56g/mol

Ref: 54-OR1054013