CAS 889949-29-5
:N-(2-ethoxybenzyl)cyclopropanamine
Description:
N-(2-ethoxybenzyl)cyclopropanamine is an organic compound characterized by its unique structure, which includes a cyclopropane ring and an ethoxybenzyl group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the ethoxy group may enhance its lipophilicity, potentially affecting its biological activity and interaction with cellular membranes. Cyclopropane derivatives often exhibit interesting reactivity due to the strain in the three-membered ring, which can lead to unique chemical behavior. The compound may also possess specific pharmacological properties, making it of interest in medicinal chemistry. Its molecular interactions, stability, and reactivity can be influenced by the substituents on the benzyl and cyclopropane moieties. Overall, N-(2-ethoxybenzyl)cyclopropanamine represents a class of compounds that can be explored for various applications in drug development and organic synthesis.
Formula:C12H17NO
InChI:InChI=1/C12H17NO/c1-2-14-12-6-4-3-5-10(12)9-13-11-7-8-11/h3-6,11,13H,2,7-9H2,1H3
SMILES:CCOc1ccccc1CNC1CC1
Synonyms:- benzenemethanamine, N-cyclopropyl-2-ethoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
