CAS 889949-75-1
:N-(3-phenylprop-2-yn-1-yl)butan-2-amine
Description:
N-(3-phenylprop-2-yn-1-yl)butan-2-amine, with the CAS number 889949-75-1, is an organic compound characterized by its unique structure that includes a butan-2-amine backbone and a phenylprop-2-yn-1-yl substituent. This compound features an alkyne functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the phenyl group enhances its aromatic characteristics, potentially influencing its solubility and interaction with other molecules. As an amine, it can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The compound's specific properties, such as melting point, boiling point, and solubility, would depend on its molecular interactions and the presence of functional groups. Due to its structural complexity, it may exhibit interesting biological activities, making it a candidate for further research in medicinal chemistry. However, detailed studies would be necessary to fully understand its properties and potential applications.
Formula:C13H17N
InChI:InChI=1/C13H17N/c1-3-12(2)14-11-7-10-13-8-5-4-6-9-13/h4-6,8-9,12,14H,3,11H2,1-2H3
SMILES:CCC(C)NCC#Cc1ccccc1
Synonyms:- 2-butanamine, N-(3-phenyl-2-propyn-1-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
