CAS 889949-80-8

N-(3-methoxybenzyl)butan-2-amine

Description:

N-(3-methoxybenzyl)butan-2-amine, with the CAS number 889949-80-8, is an organic compound characterized by its amine functional group and a butan-2-amine backbone. This compound features a methoxy-substituted benzyl group, which contributes to its unique chemical properties. The presence of the methoxy group enhances its lipophilicity, potentially influencing its solubility in organic solvents and biological membranes. As an amine, it may exhibit basic properties, allowing it to participate in various chemical reactions, including alkylation and acylation. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. Additionally, the presence of both aromatic and aliphatic components may impart interesting electronic and steric characteristics, which could affect its reactivity and interaction with other molecules. Overall, N-(3-methoxybenzyl)butan-2-amine is a compound of interest for further study in both synthetic and biological contexts.

Formula: C₁₂H₁₉NO

InChI: InChI=1/C12H19NO/c1-4-10(2)13-9-11-6-5-7-12(8-11)14-3/h5-8,10,13H,4,9H2,1-3H3

SMILES: CCC(C)NCc1cccc(c1)OC

Synonyms:

• benzenemethanamine, 3-methoxy-N-(1-methylpropyl)-
• N-(3-Methoxybenzyl)butan-2-amine

(butan-2-yl)[(3-methoxyphenyl)methyl]amine

CAS: 889949-80-8

Formula: C₁₂H₁₉NO

Molecular weight: 193.2854

Ref: IN-DA0045M0

N-(3-methoxybenzyl)-2-butanamine hydrochloride

CAS: 889949-80-8

Formula: C₁₂H₂₀ClNO

Purity: 95.0%

Molecular weight: 229.75

Ref: 10-F361797