CymitQuimica logo

CAS 889949-94-4

:

2-[(furan-2-ylmethyl)amino]-2-methylpropan-1-ol

Description:
2-[(Furan-2-ylmethyl)amino]-2-methylpropan-1-ol is an organic compound characterized by its unique structure, which includes a furan ring and an amino alcohol functional group. The presence of the furan moiety contributes to its aromatic properties, while the amino alcohol portion provides potential for hydrogen bonding and solubility in polar solvents. This compound typically exhibits moderate polarity due to the hydroxyl (-OH) group and the amino (-NH) group, which can engage in both hydrogen bonding and dipole-dipole interactions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both an amine and an alcohol, which can influence biological activity. Additionally, the furan ring may impart specific reactivity or biological properties, making it a subject of interest in various chemical research fields. Overall, the compound's characteristics, including its solubility, reactivity, and potential biological activity, make it a valuable candidate for further study in organic and medicinal chemistry.
Formula:C9H15NO2
InChI:InChI=1/C9H15NO2/c1-9(2,7-11)10-6-8-4-3-5-12-8/h3-5,10-11H,6-7H2,1-2H3
SMILES:CC(C)(CO)NCc1ccco1
Synonyms:
  • 1-Propanol, 2-[(2-Furanylmethyl)Amino]-2-Methyl-
  • 2-[(2-Furylmethyl)amino]-2-methylpropan-1-ol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.