CAS 889950-02-1

N-[4-(1-methylethyl)benzyl]propan-1-amine

Description:

N-[4-(1-methylethyl)benzyl]propan-1-amine, identified by its CAS number 889950-02-1, is an organic compound characterized by its amine functional group and a complex aromatic structure. This substance features a propan-1-amine backbone, which is substituted with a benzyl group that has an isopropyl group at the para position. The presence of the isopropyl group contributes to its hydrophobic characteristics, influencing its solubility and interaction with biological systems. Typically, compounds of this nature may exhibit properties such as moderate to high lipophilicity, which can affect their pharmacokinetics and bioavailability if considered for pharmaceutical applications. Additionally, the amine group can participate in hydrogen bonding, potentially impacting its reactivity and interactions with other molecules. Safety and handling considerations are essential, as with many amines, due to potential irritant properties. Overall, the unique structural features of N-[4-(1-methylethyl)benzyl]propan-1-amine suggest it may have specific applications in medicinal chemistry or as a building block in organic synthesis.

Formula: C₁₃H₂₁N

InChI: InChI=1/C13H21N/c1-4-9-14-10-12-5-7-13(8-6-12)11(2)3/h5-8,11,14H,4,9-10H2,1-3H3

SMILES: CCCNCc1ccc(cc1)C(C)C

Synonyms:

• benzenemethanamine, 4-(1-methylethyl)-N-propyl-
• N-(4-Isopropylbenzyl)propan-1-amine

N-(4-isopropylbenzyl)-1-propanamine hydrochloride

CAS: 889950-02-1

Formula: C₁₃H₂₂ClN

Purity: 95.0%

Molecular weight: 227.78

Ref: 10-F361709