CAS 889955-12-8

3-(2,3-dihydro-1H-1,5-benzodiazepin-4-yl)phenol

Description:

3-(2,3-dihydro-1H-1,5-benzodiazepin-4-yl)phenol, identified by its CAS number 889955-12-8, is a chemical compound that features a benzodiazepine moiety fused to a phenolic structure. This compound typically exhibits characteristics associated with both benzodiazepines and phenolic compounds, including potential biological activity. Benzodiazepines are known for their psychoactive properties, often acting as anxiolytics, sedatives, or muscle relaxants, while phenolic compounds can exhibit antioxidant properties and influence various biochemical pathways. The presence of the benzodiazepine ring suggests that this compound may interact with the central nervous system, potentially modulating neurotransmitter activity. Additionally, the hydroxyl group in the phenolic part can contribute to hydrogen bonding and solubility in polar solvents. Overall, the specific characteristics, including its pharmacological effects, solubility, and stability, would depend on its molecular structure and the functional groups present, making it a subject of interest in medicinal chemistry and drug development.

Formula: C₁₅H₁₄N₂O

InChI: InChI=1/C15H14N2O/c18-12-5-3-4-11(10-12)13-8-9-16-14-6-1-2-7-15(14)17-13/h1-7,10,16,18H,8-9H2

SMILES: c1ccc2c(c1)NCCC(=N2)c1cccc(c1)O

Synonyms:

• phenol, 3-(2,3-dihydro-1H-1,5-benzodiazepin-4-yl)-
• 3-(2,3-Dihydro-1H-1,5-benzodiazepin-4-yl)phenol

3-(4,5-Dihydro-3H-benzo[b][1,4]diazepin-2-yl)-phenol

CAS: 889955-12-8

Formula: C₁₅H₁₄N₂O

Molecular weight: 238.2845

Ref: IN-DA0046AL

2,3-Dihydro-4-(3-hydroxyphenyl)-1H-1,5-benzodiazepine

CAS: 889955-12-8

2,3-Dihydro-4-(3-hydroxyphenyl)-1H-1,5-benzodiazepine

Purity: 95%

Molecular weight: 238.28g/mol

Ref: 54-OR01589