CAS 889956-81-4
:tert-butyl 3-(4-hydroxyphenyl)piperazine-1-carboxylate
Description:
Tert-butyl 3-(4-hydroxyphenyl)piperazine-1-carboxylate, identified by its CAS number 889956-81-4, is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a tert-butyl ester group, enhancing its lipophilicity and potentially influencing its pharmacokinetic properties. The presence of a 4-hydroxyphenyl substituent contributes to its potential biological activity, as phenolic groups are often involved in interactions with biological targets. The carboxylate functional group indicates that this compound can participate in various chemical reactions, including esterification and amidation. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric conditions, given the role of piperazine derivatives in drug design. Additionally, the compound's solubility and stability can be influenced by the tert-butyl group, making it a candidate for further research in drug formulation and delivery systems.
Formula:C15H22N2O3
InChI:InChI=1/C15H22N2O3/c1-15(2,3)20-14(19)17-9-8-16-13(10-17)11-4-6-12(18)7-5-11/h4-7,13,16,18H,8-10H2,1-3H3
SMILES:CC(C)(C)OC(=O)N1CCNC(C1)c1ccc(cc1)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
