CAS 889957-87-3: 2-(3-methylpiperazin-1-yl)pyridine-3-carboxylic acid

Description:2-(3-Methylpiperazin-1-yl)pyridine-3-carboxylic acid is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a carboxylic acid group and a 3-methylpiperazine moiety. This compound typically exhibits properties associated with both heterocyclic and aromatic compounds, including potential basicity due to the nitrogen atoms in the piperazine ring. The presence of the carboxylic acid group contributes to its acidity and solubility in polar solvents. It may also participate in hydrogen bonding, influencing its interactions in biological systems. The compound is of interest in medicinal chemistry, particularly for its potential pharmacological applications, as piperazine derivatives are often associated with various biological activities. Additionally, its molecular structure suggests it may interact with specific receptors or enzymes, making it a candidate for further research in drug development. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula:C₁₁H₁₅N₃O₂

InChI:InChI=1/C11H15N3O2/c1-8-7-14(6-5-12-8)10-9(11(15)16)3-2-4-13-10/h2-4,8,12H,5-7H2,1H3,(H,15,16)

Synonyms:
2-(3-Methyl-1-piperazinyl)nicotinic acid
2-(3-Methylpiperazin-1-yl)nicotinic acid
3-Pyridinecarboxylic Acid, 2-(3-Methyl-1-Piperazinyl)-

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	2-(3-methylpiperazin-1-yl)pyridine-3-carboxylic acid REF: 10-F526222CAS: 889957-87-3	95.0%	To inquire	Wed 07 May 25
	2-(3-Methylpiperazin-1-yl)nicotinic acid REF: 3D-PKB95787CAS: 889957-87-3	Min. 95%	- - -	Discontinued product