CAS 88999-92-2

4-Bromobenzeneethanethiol

Description:

4-Bromobenzeneethanethiol, also known as 4-bromobenzenethanethiol, is an organosulfur compound characterized by the presence of a thiol (-SH) group attached to a benzene ring that is further substituted with a bromine atom at the para position. This compound typically appears as a colorless to pale yellow liquid with a distinct odor. It is soluble in organic solvents but has limited solubility in water due to the hydrophobic nature of the aromatic ring. The presence of the bromine atom enhances its reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the thiol group contributes to its potential applications in organic synthesis, materials science, and as a ligand in coordination chemistry. Safety precautions should be observed when handling this compound, as thiols can be toxic and have strong odors. Overall, 4-bromobenzeneethanethiol is a valuable compound in synthetic organic chemistry and materials development.

Formula: C₈H₉BrS

InChI: InChI=1S/C8H9BrS/c9-8-3-1-7(2-4-8)5-6-10/h1-4,10H,5-6H2

InChI key: InChIKey=SXXIKGSVHPGXFA-UHFFFAOYSA-N

SMILES: C(CS)C1=CC=C(Br)C=C1

Synonyms:

• 4-Bromobenzeneethanethiol
• Benzeneethanethiol, 4-bromo-
• 2-(4-Bromophenyl)ethane-1-thiol
• 2-(4-Bromophenyl)ethanethiol