CAS 89-05-4
:Pyromellitic acid
Description:
Pyromellitic acid, also known as 1,2,4,5-benzenetetracarboxylic acid, is an aromatic dicarboxylic acid characterized by its four carboxylic acid functional groups attached to a benzene ring. It appears as a white crystalline solid and is soluble in water, alcohols, and other polar solvents. The compound has a melting point that typically falls within a moderate range, and it exhibits strong acidity due to the presence of multiple carboxylic acid groups. Pyromellitic acid is primarily used in the production of polyimides, which are high-performance polymers, and as a cross-linking agent in various applications, including coatings and adhesives. Additionally, it serves as a precursor for the synthesis of other chemical compounds and can be involved in the formation of metal-organic frameworks. Its structure allows for significant reactivity, making it valuable in organic synthesis and materials science. Safety precautions should be observed when handling pyromellitic acid, as it can cause irritation to the skin and eyes.
Formula:C10H6O8
InChI:InChI=1S/C10H6O8/c11-7(12)3-1-4(8(13)14)6(10(17)18)2-5(3)9(15)16/h1-2H,(H,11,12)(H,13,14)(H,15,16)(H,17,18)
InChI key:InChIKey=CYIDZMCFTVVTJO-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C(O)=O)C=C(C(O)=O)C(C(O)=O)=C1
Synonyms:- 1,2,4,5-Tetracarboxybenzene
- Acide Benzene-1,2,4,5-Tetracarboxylique
- Acido Benceno-1,2,4,5-Tetracarboxilico
- Benzene-1,2,4,5-Tetracarboxylate
- Benzene-1,2,4,5-Tetracarboxylic Acid
- Benzol-1,2,4,5-tetracarbonsaure
- Nsc 6369
- Pyromellitic acid
- Pyromellitic acid hydrate
- 1,2,4,5-Benzenetetracarboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Pyromellitic Acid
CAS:Formula:C10H6O8Purity:>98.0%(T)Color and Shape:White to Almost white powder to crystalMolecular weight:254.15Benzene-1,2,4,5-tetracarboxylic acid
CAS:Formula:C10H6O8Purity:95%Color and Shape:SolidMolecular weight:254.15Pyromellitic acid, 96%
CAS:Pyromellitic acid is an eluent used in anion chromatography and forms complexes with magnesium and calcium ions. It is used as a curing agent, as an intermediate for powder coating and a cross-linking agent for alkyd resin. It is involved in the synthesis of polyimide and pyromellitic octyl. This Th
Formula:C10H6O8Purity:96%Color and Shape:White, PowderMolecular weight:254.15Benzene-1,2,4,5-tetracarboxylic acid
CAS:Formula:C10H6O8Purity:95%Color and Shape:SolidMolecular weight:254.14981,2,4,5-Benzenetetracarboxylic acid
CAS:1,2,4,5-Benzenetetracarboxylic acidPurity:98%Molecular weight:254.15g/mol1,2,4,5-Benzenetetracarboxylic Acid
CAS:Controlled ProductApplications 1,2,4,5-BENZENETETRACARBOXYLIC ACID (cas# 89-05-4) is a useful research chemical.
Formula:C10H6O8Color and Shape:NeatMolecular weight:254.15





