
CAS 89-07-6
:1-(1-Methylethyl)-2,4-dinitrobenzene
Description:
1-(1-Methylethyl)-2,4-dinitrobenzene, commonly known as 2,4-Dinitro-1-isopropylbenzene, is an organic compound characterized by its aromatic structure featuring two nitro groups (-NO2) positioned at the 2 and 4 positions of a benzene ring, along with an isopropyl group (-C3H7) at the 1 position. This compound typically appears as a yellow crystalline solid and is known for its relatively low solubility in water but higher solubility in organic solvents. It exhibits properties such as being a potential explosive under certain conditions due to the presence of nitro groups, which are known for their energetic characteristics. The compound is used in various chemical syntheses and research applications, particularly in the field of organic chemistry. Safety precautions are essential when handling this substance, as it may pose health risks through inhalation or skin contact. Proper storage and disposal methods should be followed to mitigate environmental impact and ensure safety.
Formula:C9H10N2O4
InChI:InChI=1S/C9H10N2O4/c1-6(2)8-4-3-7(10(12)13)5-9(8)11(14)15/h3-6H,1-2H3
InChI key:InChIKey=BAWGGSYXBBWRAO-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(C(C)C)C=CC(N(=O)=O)=C1
Synonyms:- 1-(1-Methylethyl)-2,4-dinitrobenzene
- Cumene, 2,4-dinitro-
- Benzene, 1-(1-methylethyl)-2,4-dinitro-
- 2,4-Dinitro-1-isopropylbenzene
- 2,4-Dinitroisopropylbenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.