CAS 89-50-9
:2-(Ethylamino)benzoic acid
Description:
2-(Ethylamino)benzoic acid, also known as ethylaminobenzoic acid, is an aromatic amino acid derivative characterized by the presence of both an ethylamino group and a carboxylic acid group attached to a benzene ring. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols, owing to its polar functional groups. It has a melting point that varies depending on purity and specific conditions. The presence of the ethylamino group imparts basic properties, allowing it to participate in various chemical reactions, including acylation and amidation. This compound is often utilized in pharmaceutical applications, particularly in the synthesis of drugs and as an intermediate in organic synthesis. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling, as it may pose health risks if ingested or inhaled.
Formula:C9H11NO2
InChI:InChI=1/C9H11NO2/c1-2-10-8-6-4-3-5-7(8)9(11)12/h3-6,10H,2H2,1H3,(H,11,12)
InChI key:InChIKey=SPEGUNZOHLFGCL-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(NCC)C=CC=C1
Synonyms:- Anthranilic acid, N-ethyl-
- Anthranilic acid, N-ethyl- (8CI)
- Benzoic acid, 2-(ethylamino)-
- N-Ethylanthranilic acid
- Nsc 16162
- 2-(Ethylamino)benzoic acid
- 2-(Ethylamino)benzoic acid
- 2-Ethylaminobenzoesure
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.