CAS 89-51-0: Homophthalic acid
Description:Homophthalic acid, with the CAS number 89-51-0, is an organic compound that belongs to the class of dicarboxylic acids. It is characterized by its two carboxylic acid functional groups (-COOH) attached to a bicyclic aromatic structure, specifically derived from phthalic acid. This compound typically appears as a white crystalline solid and is soluble in polar solvents such as water and alcohols. Homophthalic acid is known for its applications in the synthesis of various polymers, resins, and as an intermediate in organic synthesis. Its chemical structure allows for the formation of esters and anhydrides, making it versatile in chemical reactions. Additionally, it exhibits properties such as moderate melting and boiling points, which are typical for dicarboxylic acids. The compound is also of interest in materials science and can be used in the production of specialty chemicals. Safety precautions should be taken when handling homophthalic acid, as with many organic compounds, to avoid potential health hazards.
Formula:C9H8O4
InChI:InChI=1S/C9H8O4/c10-8(11)5-6-3-1-2-4-7(6)9(12)13/h1-4H,5H2,(H,10,11)(H,12,13)
InChI key:InChIKey=ZHQLTKAVLJKSKR-UHFFFAOYSA-N
SMILES:O=C(O)C=1C=CC=CC1CC(=O)O
- Synonyms:
- (2-Carboxyphenyl)acetic acid
- (o-Carboxymethyl)benzoic acid
- 2-(Carboxymethyl)Benzoic Acid
- 2-Carboxybenzeneacetic acid
- 2-Carboxymethylbenzoic acid
- Benzeneacetic Acid, 2-Carboxy-
- Homophthalic acid,(o-Carboxyphenylacetic acid)
- NSC 149596
- NSC 15185
- NSC 401692
- See more synonyms
- Toluene-α,2-dicarboxylic acid
- alpha-Carboxy-o-toluic acid
- o-Carboxybenzeneacetic acid
- o-Carboxyphenylacetic acid
- o-Toluic acid, α-carboxy-
- α-Carboxy-o-toluic acid
- Homophthalic acid
