
CAS 890-35-7
:N-Hydroxy-β-phenylbenzenepropanimidamide
Description:
N-Hydroxy-β-phenylbenzenepropanimidamide, with the CAS number 890-35-7, is a chemical compound characterized by its unique structural features, which include a hydroxyl group and an amidine functional group. This compound typically exhibits properties associated with both amines and hydroxyl compounds, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding. The presence of the phenyl group contributes to its aromatic characteristics, which can influence its reactivity and stability. N-Hydroxy-β-phenylbenzenepropanimidamide may be utilized in various chemical applications, including as a reagent in organic synthesis or as a potential pharmaceutical intermediate. Its specific reactivity and applications would depend on the functional groups present and the overall molecular structure. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity. Further studies and data would be necessary to fully elucidate its properties and applications in various fields.
Formula:C15H16N2O
InChI:InChI=1S/C15H16N2O/c16-15(17-18)11-14(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,14,18H,11H2,(H2,16,17)
InChI key:InChIKey=UMVCPAZWYLAETQ-UHFFFAOYSA-N
SMILES:C(CC(NO)=N)(C1=CC=CC=C1)C2=CC=CC=C2
Synonyms:- N-Hydroxy-β-phenylbenzenepropanimidamide
- Benzenepropanimidamide, N-hydroxy-β-phenyl-
- Propionamidoxime, 3,3-diphenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
