CAS 890-51-7

N-[(E)-phenylmethylidene]naphthalen-1-amine

Description:

N-[(E)-phenylmethylidene]naphthalen-1-amine, also known by its CAS number 890-51-7, is an organic compound characterized by its structure, which features a naphthalene moiety linked to an imine functional group. This compound typically exhibits a deep color, often associated with its conjugated double bond system, which can contribute to its optical properties. It is generally soluble in organic solvents, reflecting its hydrophobic nature due to the aromatic rings present in its structure. The presence of the imine group (C=N) suggests potential reactivity, particularly in nucleophilic addition reactions. This compound may also exhibit interesting photophysical properties, making it of interest in fields such as organic electronics or dye chemistry. Additionally, its structural features may impart biological activity, warranting investigation in medicinal chemistry. Overall, N-[(E)-phenylmethylidene]naphthalen-1-amine is a compound of interest due to its unique structural characteristics and potential applications in various chemical domains.

Formula: C₁₇H₁₃N

InChI: InChI=1/C17H13N/c1-2-7-14(8-3-1)13-18-17-12-6-10-15-9-4-5-11-16(15)17/h1-13H/b18-13+

Synonyms:

• 1-naphthalenamine, N-[(1E)-phenylmethylene]-
• N-(1-naphthyl)-N-(phenylmethylene)amine
• N-[(E)-Phenylmethylene]naphthalen-1-amine

(E)-N-(naphthalen-1-yl)-1-phenylmethanimine

CAS: 890-51-7

Formula: C₁₇H₁₃N

Molecular weight: 231.2918

Ref: IN-DA0041NY