CAS 890014-20-7

[(6-methylthieno[2,3-d]pyrimidin-4-yl)sulfanyl]acetic acid

Description:

The chemical substance known as [(6-methylthieno[2,3-d]pyrimidin-4-yl)sulfanyl]acetic acid, with the CAS number 890014-20-7, is characterized by its unique structural features that include a thieno[2,3-d]pyrimidine core, which contributes to its potential biological activity. This compound contains a sulfanyl group, indicating the presence of a sulfur atom bonded to a carbon atom, which can influence its reactivity and solubility. The acetic acid moiety suggests that it possesses acidic properties, allowing it to participate in various chemical reactions, including esterification and salt formation. The methyl group on the thieno ring may enhance lipophilicity, potentially affecting its pharmacokinetic properties. Overall, this compound may exhibit interesting interactions with biological targets, making it of interest in medicinal chemistry and drug development. Its specific characteristics, such as melting point, solubility, and spectral data, would require empirical measurement or literature reference for detailed analysis.

Formula: C₉H₈N₂O₂S₂

InChI: InChI=1/C9H8N2O2S2/c1-5-2-6-8(14-3-7(12)13)10-4-11-9(6)15-5/h2,4H,3H2,1H3,(H,12,13)

SMILES: Cc1cc2c(ncnc2s1)SCC(=O)O

[(6-methylthieno[2,3-d]pyrimidin-4-yl)thio]acetic acid

CAS: 890014-20-7

Formula: C₉H₈N₂O₂S₂

Purity: 95.0%

Molecular weight: 240.3

Ref: 10-F315733