CAS 890014-38-7
:4-methyl-5-phenyl-1H-pyrazol-3-amine
Description:
4-Methyl-5-phenyl-1H-pyrazol-3-amine is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features a methyl group at the 4-position and a phenyl group at the 5-position of the pyrazole ring, along with an amino group at the 3-position. The presence of these functional groups contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The compound is likely to exhibit moderate solubility in organic solvents due to its hydrophobic phenyl group, while the amino group may impart some degree of polarity. Additionally, the compound may participate in hydrogen bonding due to the amino group, influencing its interactions in biological systems. Its specific properties, such as melting point, boiling point, and spectral characteristics, would require experimental determination or reference to literature for precise values. Overall, 4-methyl-5-phenyl-1H-pyrazol-3-amine is of interest for its potential biological activity and utility in synthetic chemistry.
Formula:C10H11N3
InChI:InChI=1/C10H11N3/c1-7-9(12-13-10(7)11)8-5-3-2-4-6-8/h2-6H,1H3,(H3,11,12,13)
SMILES:Cc1c(c2ccccc2)[nH][nH]c1=N
Synonyms:- 1H-pyrazol-5-amine, 4-methyl-3-phenyl-
- 4-Methyl-3-phenyl-1H-pyrazol-5-amine
- 4-Methyl-5-phenyl-1H-pyrazol-3-amine
- UKRORGSYN-BB BBV-5096113
- 2Amino1(4chlorophenyl)ethanone hydrochloride
- AKOS BBS-00001778
- 4-methyl-3-phenyl-1H-pyrazol-5-amine(SALTDATA: FREE)
- 4methyl3phenylpyrazole5ylamine
- 4-METHYL-5-PHENYL-2H-PYRAZOL-3-YLAMINE
- CHEMBRDG-BB 4002018
- (4-methyl-5-phenyl-1H-pyrazol-3-yl)amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
