CAS 890014-48-9

5-Amino-3-phenyl-1H-pyrazole-1-acetic acid

Description:

5-Amino-3-phenyl-1H-pyrazole-1-acetic acid is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features an amino group (-NH2) and a phenyl group (C6H5) attached to the pyrazole ring, along with an acetic acid moiety (-COOH) that contributes to its acidic properties. The presence of the amino group makes it a potential candidate for various biological activities, including anti-inflammatory and analgesic effects. Its phenyl substituent can enhance lipophilicity, potentially influencing its pharmacokinetic properties. The compound is typically synthesized through multi-step organic reactions, and its solubility can vary depending on the pH of the solution due to the carboxylic acid group. As with many pyrazole derivatives, it may exhibit interesting interactions with biological targets, making it a subject of interest in medicinal chemistry and drug development. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₁H₁₁N₃O₂

InChI: InChI=1S/C11H11N3O2/c12-10-6-9(8-4-2-1-3-5-8)13-14(10)7-11(15)16/h1-6H,7,12H2,(H,15,16)

InChI key: InChIKey=WNFHTBGHJPWRNB-UHFFFAOYSA-N

SMILES: C(C(O)=O)N1N=C(C=C1N)C2=CC=CC=C2

Synonyms:

• 5-Amino-3-phenyl-1H-pyrazole-1-acetic acid
• 1H-Pyrazole-1-acetic acid, 5-amino-3-phenyl-

2-(5-Amino-3-phenyl-1H-pyrazol-1-yl)acetic acid

CAS: 890014-48-9

Versatile small molecule scaffold

Formula: C₁₁H₁₁N₃O₂

Purity: Min. 95%

Molecular weight: 217.22 g/mol

Ref: 3D-QKB01448