CAS 890043-20-6

6-chloro-1-[4-(trifluoromethyl)phenyl]hexan-1-one

Description:

6-Chloro-1-[4-(trifluoromethyl)phenyl]hexan-1-one is an organic compound characterized by its unique molecular structure, which includes a hexanone backbone substituted with a chloro group and a trifluoromethylphenyl moiety. The presence of the chloro substituent introduces a degree of polarity and can influence the compound's reactivity and solubility in various solvents. The trifluoromethyl group is known for its electron-withdrawing properties, which can enhance the compound's biological activity and stability. This compound is likely to exhibit moderate to high lipophilicity due to the hydrophobic nature of the hexane chain and the aromatic ring, making it potentially useful in pharmaceutical applications. Additionally, the presence of both halogen and carbonyl functional groups suggests that it may participate in various chemical reactions, such as nucleophilic substitutions or reductions. Overall, 6-chloro-1-[4-(trifluoromethyl)phenyl]hexan-1-one is a versatile compound with potential applications in medicinal chemistry and material science.

Formula: C₁₃H₁₄ClF₃O

InChI: InChI=1/C13H14ClF3O/c14-9-3-1-2-4-12(18)10-5-7-11(8-6-10)13(15,16)17/h5-8H,1-4,9H2

SMILES: C(CCC(=O)c1ccc(cc1)C(F)(F)F)CCCl

6-chloro-1-oxo-1-(4-trifluoromethylphenyl)hexane

CAS: 890043-20-6

Formula: C₁₃H₁₄ClF₃O

Purity: 97.0%

Molecular weight: 278.7

Ref: 10-F203717