CAS 890044-58-3
:Methyl (αR)-α-amino-7-methyl-1H-indazole-5-propanoate
Description:
Methyl (αR)-α-amino-7-methyl-1H-indazole-5-propanoate, with CAS number 890044-58-3, is a chemical compound characterized by its indazole core structure, which is a bicyclic compound containing a five-membered ring fused to a six-membered ring. This compound features an amino group, a methyl group at the 7-position, and a propanoate moiety, contributing to its overall functionality. The presence of the α-amino group indicates that it can participate in various biochemical interactions, making it relevant in medicinal chemistry and pharmacology. The stereochemistry denoted by (αR) suggests a specific spatial arrangement of atoms, which can significantly influence the compound's biological activity and interactions with receptors or enzymes. Methyl (αR)-α-amino-7-methyl-1H-indazole-5-propanoate may exhibit properties such as solubility in organic solvents, potential for forming salts, and reactivity with other chemical species, which are important for its applications in research and development. Overall, this compound's unique structure and functional groups make it a subject of interest in various scientific fields.
Formula:C12H15N3O2
InChI:InChI=1S/C12H15N3O2/c1-7-3-8(5-10(13)12(16)17-2)4-9-6-14-15-11(7)9/h3-4,6,10H,5,13H2,1-2H3,(H,14,15)/t10-/m1/s1
InChI key:InChIKey=IWYBATOKIPKBEJ-SNVBAGLBSA-N
SMILES:CC1=C2C(=CC(C[C@H](C(OC)=O)N)=C1)C=NN2
Synonyms:- 1H-Indazole-5-propanoic acid, α-amino-7-methyl-, methyl ester, (αR)-
- Methyl (R)-2-amino-3-(7-methyl-1H-indazol-5-yl)propanoate
- (R)-Methyl 2-amino-3-(7-methyl-1H-indazol-5-yl)propanoate
- Methyl (αR)-α-amino-7-methyl-1H-indazole-5-propanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
