
CAS 890046-37-4
:3,5-Pyridinedicarboxylic acid, 2-[(2-aminoethoxy)methyl]-4-(2-chlorophenyl)-1,4-dihydro-6-methyl-, 3-ethyl 5-methyl ester, (4R)-, (2R,3R)-2,3-bis(benzoyloxy)butanedioate (2:1)
Description:
3,5-Pyridinedicarboxylic acid, 2-[(2-aminoethoxy)methyl]-4-(2-chlorophenyl)-1,4-dihydro-6-methyl-, 3-ethyl 5-methyl ester, (4R)-, (2R,3R)-2,3-bis(benzoyloxy)butanedioate (2:1) is a complex organic compound characterized by its multiple functional groups and stereochemistry. It features a pyridine ring with carboxylic acid substituents, which contribute to its acidic properties and potential for forming salts or esters. The presence of an aminoethoxy group suggests potential for hydrogen bonding and increased solubility in polar solvents. The chlorophenyl moiety may impart unique electronic properties, influencing reactivity and biological activity. Additionally, the compound's stereochemistry, indicated by the (4R) and (2R,3R) designations, suggests specific spatial arrangements that can affect its interaction with biological targets. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry. Its ester groups can also suggest potential for hydrolysis, impacting its stability and reactivity in various environments. Overall, this compound's intricate structure and functional diversity make it a subject of interest for further research and application in chemical and pharmaceutical fields.
Formula:C20H25ClN2O5C18H14O8
InChI:InChI=1S/C20H25ClN2O5.C18H14O8/c1-4-28-20(25)18-15(11-27-10-9-22)23-12(2)16(19(24)26-3)17(18)13-7-5-6-8-14(13)21;19-15(20)13(25-17(23)11-7-3-1-4-8-11)14(16(21)22)26-18(24)12-9-5-2-6-10-12/h5-8,17,23H,4,9-11,22H2,1-3H3;1-10,13-14H,(H,19,20)(H,21,22)/t17-;13-,14-/m11/s1
InChI key:InChIKey=HGESXLUHWHUOLN-YVGNGXOTSA-N
SMILES:C(OCC)(=O)C=1[C@@H](C(C(OC)=O)=C(C)NC1COCCN)C2=C(Cl)C=CC=C2.[C@H]([C@@H](OC(=O)C1=CC=CC=C1)C(O)=O)(OC(=O)C2=CC=CC=C2)C(O)=O
Synonyms:- (R)-(+)-Amlodipine hemi-dibenzoyl-L-tartrate
- 3,5-Pyridinedicarboxylic acid, 2-[(2-aminoethoxy)methyl]-4-(2-chlorophenyl)-1,4-dihydro-6-methyl-, 3-ethyl 5-methyl ester, (4R)-, (2R,3R)-2,3-bis(benzoyloxy)butanedioate (2:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(R)-Amlodipine-d4 Di-O-benzoyl L-Tartaric Acid Salt
CAS:Controlled ProductFormula:C20D4H21ClN2O5·C18H14O8Color and Shape:NeatMolecular weight:771.199
