
CAS 89009-59-6
:N-Ethyl-1-piperazinepropanamide
Description:
N-Ethyl-1-piperazinepropanamide, with the CAS number 89009-59-6, is a chemical compound characterized by its amide functional group and a piperazine ring structure. This compound typically exhibits properties associated with amides, such as moderate polarity and the ability to engage in hydrogen bonding, which can influence its solubility in polar solvents. The presence of the ethyl group contributes to its hydrophobic characteristics, potentially affecting its interaction with biological systems. N-Ethyl-1-piperazinepropanamide may be utilized in various applications, including pharmaceuticals and chemical synthesis, due to its structural features that can facilitate interactions with biological targets. Additionally, the compound's stability and reactivity can be influenced by the piperazine moiety, which is known for its role in enhancing the pharmacological properties of drug candidates. Overall, this compound's unique structure and functional groups make it a subject of interest in medicinal chemistry and related fields.
Formula:C9H19N3O
InChI:InChI=1S/C9H19N3O/c1-2-11-9(13)3-6-12-7-4-10-5-8-12/h10H,2-8H2,1H3,(H,11,13)
InChI key:InChIKey=ZATMZGDZECLGJL-UHFFFAOYSA-N
SMILES:C(CC(NCC)=O)N1CCNCC1
Synonyms:- N-Ethyl-1-piperazinepropanamide
- 1-Piperazinepropanamide, N-ethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
