
CAS 89009-62-1
:N-Butyl-1-piperazinepropanamide
Description:
N-Butyl-1-piperazinepropanamide is a chemical compound characterized by its amide functional group and a piperazine ring, which contributes to its potential biological activity. This substance typically appears as a colorless to pale yellow liquid or solid, depending on its specific formulation and purity. It is soluble in polar organic solvents, reflecting its moderate hydrophilicity due to the presence of the amide group. The compound's structure includes a butyl chain, which enhances its lipophilicity, potentially influencing its interaction with biological membranes. N-Butyl-1-piperazinepropanamide may exhibit pharmacological properties, making it of interest in medicinal chemistry and drug development. Its stability and reactivity can be influenced by environmental factors such as pH and temperature. Safety data should be consulted to understand its toxicity and handling precautions, as with any chemical substance. Overall, N-Butyl-1-piperazinepropanamide represents a unique molecular entity with potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C11H23N3O
InChI:InChI=1S/C11H23N3O/c1-2-3-5-13-11(15)4-8-14-9-6-12-7-10-14/h12H,2-10H2,1H3,(H,13,15)
InChI key:InChIKey=WSSDLMMVFOJOMR-UHFFFAOYSA-N
SMILES:C(CC(NCCCC)=O)N1CCNCC1
Synonyms:- N-Butyl-1-piperazinepropanamide
- 1-Piperazinepropanamide, N-butyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
