CymitQuimica logo

CAS 89009-69-8

:

N,N-Dipropyl-1-piperazinepropanamide

Description:
N,N-Dipropyl-1-piperazinepropanamide is a chemical compound characterized by its piperazine and amide functional groups. It features a piperazine ring, which is a six-membered cyclic amine, substituted with two propyl groups and an amide chain. This structure contributes to its potential biological activity, particularly in pharmacological applications. The compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents, which is common for amide compounds, and may exhibit moderate solubility in water due to the presence of the polar amide group. The presence of the piperazine moiety suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance, to ensure proper laboratory practices. Overall, N,N-Dipropyl-1-piperazinepropanamide represents a unique structure with potential applications in various fields, including pharmaceuticals and materials science.
Formula:C13H27N3O
InChI:InChI=1S/C13H27N3O/c1-3-8-16(9-4-2)13(17)5-10-15-11-6-14-7-12-15/h14H,3-12H2,1-2H3
InChI key:InChIKey=BPIXWWCKYIPNMY-UHFFFAOYSA-N
SMILES:N(C(CCN1CCNCC1)=O)(CCC)CCC
Synonyms:
  • N,N-Dipropyl-1-piperazinepropanamide
  • 1-Piperazinepropanamide, N,N-dipropyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.