CAS 89009-71-2
:3-(1-Piperazinyl)-1-(1-piperidinyl)-1-propanone
Description:
3-(1-Piperazinyl)-1-(1-piperidinyl)-1-propanone, identified by its CAS number 89009-71-2, is a chemical compound characterized by the presence of both piperazine and piperidine moieties. This compound typically exhibits a ketone functional group, which contributes to its reactivity and potential applications in medicinal chemistry. The piperazine and piperidine rings are known for their ability to interact with various biological targets, making this compound of interest in drug development, particularly in the context of central nervous system disorders. Its structural features suggest potential for forming hydrogen bonds and engaging in various intermolecular interactions, which can influence its solubility and bioavailability. The compound may also exhibit specific pharmacological properties, although detailed studies would be necessary to elucidate its full biological profile. As with many organic compounds, safety and handling precautions should be observed, as the effects of exposure can vary based on concentration and route of administration.
Formula:C12H23N3O
InChI:InChI=1S/C12H23N3O/c16-12(15-7-2-1-3-8-15)4-9-14-10-5-13-6-11-14/h13H,1-11H2
InChI key:InChIKey=JPTHXHJEERBLLR-UHFFFAOYSA-N
SMILES:C(CCN1CCNCC1)(=O)N2CCCCC2
Synonyms:- Piperidine, 1-[1-oxo-3-(1-piperazinyl)propyl]-
- 3-(1-Piperazinyl)-1-(1-piperidinyl)-1-propanone
- 1-Propanone, 3-(1-piperazinyl)-1-(1-piperidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
