CAS 89009-72-3
:Hexahydro-N-methyl-1H-1,4-diazepine-1-propanamide
Description:
Hexahydro-N-methyl-1H-1,4-diazepine-1-propanamide, identified by its CAS number 89009-72-3, is a chemical compound characterized by its unique bicyclic structure, which includes a diazepine ring. This compound features a saturated hexahydro framework, contributing to its stability and potential biological activity. The presence of a methyl group attached to the nitrogen atom in the diazepine ring enhances its lipophilicity, which may influence its interaction with biological systems. Additionally, the propanamide functional group introduces polar characteristics, potentially affecting solubility and reactivity. Hexahydro-N-methyl-1H-1,4-diazepine-1-propanamide may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its structural features suggest potential applications in various fields, including pharmaceuticals and agrochemicals. However, specific data regarding its toxicity, environmental impact, and detailed biological activity would require further investigation and empirical studies to fully understand its characteristics and potential uses.
Formula:C9H19N3O
InChI:InChI=1S/C9H19N3O/c1-10-9(13)3-7-12-6-2-4-11-5-8-12/h11H,2-8H2,1H3,(H,10,13)
InChI key:InChIKey=SCLHHGXMZUEAOR-UHFFFAOYSA-N
SMILES:C(CC(NC)=O)N1CCCNCC1
Synonyms:- 3-(1,4-Diazepan-1-yl)-N-methylpropanamide
- 1H-1,4-Diazepine-1-propanamide, hexahydro-N-methyl-
- Hexahydro-N-methyl-1H-1,4-diazepine-1-propanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
