CAS 890091-42-6
:Polyethylene glycol 2-aminoethyl ether 2-boc-aminoethyl ether
Description:
Polyethylene glycol 2-aminoethyl ether 2-boc-aminoethyl ether, identified by its CAS number 890091-42-6, is a synthetic compound that combines polyethylene glycol (PEG) with aminoethyl ether functionalities. This substance typically exhibits characteristics such as being a colorless to pale yellow liquid or solid, depending on its molecular weight and formulation. It is soluble in water and various organic solvents, making it versatile for different applications. The presence of amino groups allows for potential reactivity in coupling reactions, while the Boc (tert-butyloxycarbonyl) protecting group provides stability and facilitates further chemical modifications. This compound is often utilized in bioconjugation, drug delivery systems, and as a polymeric scaffold in biomedical applications due to its biocompatibility and ability to form hydrophilic environments. Additionally, its properties can be tailored by adjusting the molecular weight of the polyethylene glycol component or by modifying the amino groups, enhancing its utility in various chemical and pharmaceutical contexts.
Formula:(C2H4O)nC9H20N2O3
InChI:InChI=1/C29H60N2O13/c1-29(2,3)44-28(32)31-5-7-34-9-11-36-13-15-38-17-19-40-21-23-42-25-27-43-26-24-41-22-20-39-18-16-37-14-12-35-10-8-33-6-4-30/h4-27,30H2,1-3H3,(H,31,32)
InChI key:InChIKey=OCUICOFGFQENAS-UHFFFAOYSA-N
SMILES:C(NCCOCCOCCN)(OC(C)(C)C)=O
Synonyms:- Poly(oxy-1,2-ethanediyl), α-(2-aminoethyl)-ω-[2-[[(1,1-dimethylethoxy)carbonyl]amino]ethoxy]-
- Polyethylene glycol 2-aminoethyl ether 2-boc-aminoethyl ether
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
O-(2-Aminoethyl)-O'-[2-(Boc-amino)ethyl]decaethylene glycol
CAS:Formula:C29H60N2O13Color and Shape:SolidMolecular weight:644.7923
