CAS 890091-58-4

2-(4-Morpholinyl)-3-nitrobenzoic acid

Description:

2-(4-Morpholinyl)-3-nitrobenzoic acid, with the CAS number 890091-58-4, is a chemical compound characterized by its unique structure that includes a benzoic acid moiety substituted with a nitro group and a morpholine ring. This compound typically exhibits properties such as being a solid at room temperature, with moderate solubility in polar solvents due to the presence of the carboxylic acid group. The morpholine ring contributes to its potential as a pharmacophore, enhancing its biological activity and interaction with various biological targets. The nitro group can influence the compound's reactivity and stability, making it a candidate for further chemical modifications. Additionally, this compound may exhibit specific biological activities, which can be explored in medicinal chemistry and drug development contexts. Its synthesis and characterization are important for applications in research and industry, particularly in the fields of pharmaceuticals and agrochemicals. Safety and handling precautions should be observed due to the presence of the nitro group, which can be sensitive under certain conditions.

Formula: C₁₁H₁₂N₂O₅

InChI: InChI=1S/C11H12N2O5/c14-11(15)8-2-1-3-9(13(16)17)10(8)12-4-6-18-7-5-12/h1-3H,4-7H2,(H,14,15)

InChI key: InChIKey=HMDGHIWDEAZTDZ-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(C(N(=O)=O)=CC=C1)N2CCOCC2

Synonyms:

• 2-(4-Morpholinyl)-3-nitrobenzoic acid
• Benzoic acid, 2-(4-morpholinyl)-3-nitro-

2-(Morpholin-4-yl)-3-nitrobenzoic acid

CAS: 890091-58-4

2-(Morpholin-4-yl)-3-nitrobenzoic acid

Purity: 98%

Molecular weight: 252.22g/mol

Ref: 54-OR76853

2-morpholin-4-yl-3-nitrobenzoic acid

CAS: 890091-58-4

Formula: C₁₁H₁₂N₂O₅

Purity: 98%

Molecular weight: 252.226

Ref: 10-F366454