CAS 890091-59-5

4-Methyl-1,2,5-oxadiazole-3-carboximidic acid hydrazide

Description:

4-Methyl-1,2,5-oxadiazole-3-carboximidic acid hydrazide is a chemical compound characterized by its unique oxadiazole ring structure, which contributes to its potential biological activity. This compound features a hydrazide functional group, which is known for its reactivity and ability to form various derivatives. The presence of the methyl group at the 4-position of the oxadiazole ring can influence its solubility and reactivity. Typically, compounds of this nature may exhibit properties such as antimicrobial, antifungal, or anticancer activities, making them of interest in pharmaceutical research. The hydrazide moiety can also participate in various chemical reactions, including condensation and acylation, which may be useful in synthetic applications. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 4-Methyl-1,2,5-oxadiazole-3-carboximidic acid hydrazide represents a class of compounds with diverse potential applications in medicinal chemistry and material science.

Formula: C₄H₇N₅O

InChI: InChI=1S/C4H7N5O/c1-2-3(4(5)7-6)9-10-8-2/h6H2,1H3,(H2,5,7)

InChI key: InChIKey=ZMFPNTQTNUBMSI-UHFFFAOYSA-N

SMILES: C(NN)(=N)C=1C(C)=NON1

Synonyms:

• 1,2,5-Oxadiazole-3-carboximidic acid, 4-methyl-, hydrazide
• 4-Methyl-1,2,5-oxadiazole-3-carboximidic acid hydrazide