CAS 890091-63-1

Propanedinitrile, 2-[(2-amino-2-chloro-1-cyanoethenyl)imino]-

Description:

Propanedinitrile, 2-[(2-amino-2-chloro-1-cyanoethenyl)imino]- is a chemical compound characterized by its complex structure, which includes multiple functional groups such as nitriles and an imine. This compound features a propanedinitrile backbone, which contributes to its reactivity and potential applications in organic synthesis. The presence of the amino and chloro groups suggests that it may exhibit interesting biological activity or serve as a precursor in the synthesis of more complex molecules. Its molecular structure indicates potential for hydrogen bonding and dipole interactions, which can influence its solubility and reactivity in various solvents. Additionally, the compound's CAS number, 890091-63-1, allows for precise identification in chemical databases, facilitating research and application in fields such as medicinal chemistry and materials science. Overall, the unique combination of functional groups in this compound may lead to diverse applications, although specific properties such as melting point, boiling point, and solubility would require empirical measurement for detailed characterization.

Formula: C₆H₂ClN₅

InChI: InChI=1S/C6H2ClN5/c7-6(11)5(3-10)12-4(1-8)2-9/h11H2

InChI key: InChIKey=QQNKADPBZPWGHU-UHFFFAOYSA-N

SMILES: C(N=C(C#N)C#N)(=C(Cl)N)C#N

Synonyms:

• 3-(Aminochloromethylene)-2-azaprop-1-ene-1,1,3-tricarbonitrile
• Propanedinitrile, 2-[(2-amino-2-chloro-1-cyanoethenyl)imino]-