CAS 890091-65-3
:3-Nitro-2-(1-pyrrolidinyl)benzoic acid
Description:
3-Nitro-2-(1-pyrrolidinyl)benzoic acid is an organic compound characterized by its aromatic structure, which includes a nitro group and a pyrrolidine substituent. The presence of the nitro group (-NO2) indicates that it is a nitroaromatic compound, which often exhibits unique reactivity and properties due to the electron-withdrawing nature of the nitro group. The benzoic acid moiety contributes to its acidity, allowing it to act as a weak acid in solution. The pyrrolidine ring, a five-membered saturated nitrogen-containing heterocycle, adds to the compound's potential for biological activity and interaction with various biological targets. This compound may be of interest in medicinal chemistry and drug development due to its structural features, which can influence its pharmacological properties. Additionally, its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Overall, 3-Nitro-2-(1-pyrrolidinyl)benzoic acid represents a complex structure with potential applications in various fields, including pharmaceuticals and materials science.
Formula:C11H12N2O4
InChI:InChI=1S/C11H12N2O4/c14-11(15)8-4-3-5-9(13(16)17)10(8)12-6-1-2-7-12/h3-5H,1-2,6-7H2,(H,14,15)
InChI key:InChIKey=TZXHPSXCEZFUID-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C(N(=O)=O)=CC=C1)N2CCCC2
Synonyms:- 3-Nitro-2-(1-pyrrolidinyl)benzoic acid
- Benzoic Acid, 3-Nitro-2-(1-Pyrrolidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

