
CAS 890091-67-5
:4-Aminospiro[3-azabicyclo[3.1.0]hex-3-ene-2,2′-[1,3]dioxolane]-1,5-dicarbonitrile
Description:
4-Aminospiro[3-azabicyclo[3.1.0]hex-3-ene-2,2′-[1,3]dioxolane]-1,5-dicarbonitrile is a complex organic compound characterized by its unique bicyclic structure, which includes a spiro connection and multiple functional groups. The presence of an amino group suggests potential basicity and reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions. The dicarbonitrile moieties indicate that the compound may exhibit significant electron-withdrawing properties, which can influence its reactivity and interactions with other molecules. Additionally, the dioxolane ring contributes to the compound's stability and may affect its solubility in different solvents. This compound's structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. Overall, this compound represents a fascinating example of synthetic organic chemistry with potential implications in drug design and development.
Formula:C9H8N4O2
InChI:InChI=1S/C9H8N4O2/c10-4-7-3-8(7,5-11)9(13-6(7)12)14-1-2-15-9/h1-3H2,(H2,12,13)
InChI key:InChIKey=MXAHHNJVXVSKCV-UHFFFAOYSA-N
SMILES:C(#N)C12C(C#N)(C1)C(N)=NC23OCCO3
Synonyms:- Spiro[3-azabicyclo[3.1.0]hex-3-ene-2,2′-[1,3]dioxolane]-1,5-dicarbonitrile, 4-amino-
- 4-Aminospiro[3-azabicyclo[3.1.0]hex-3-ene-2,2′-[1,3]dioxolane]-1,5-dicarbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.