CymitQuimica logo

CAS 890091-78-8

:

1-[4-(2-Amino-4-chlorophenyl)-1-piperazinyl]ethanone

Description:
1-[4-(2-Amino-4-chlorophenyl)-1-piperazinyl]ethanone, with the CAS number 890091-78-8, is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features an ethanone functional group, indicating the presence of a carbonyl group (C=O) adjacent to an ethyl group. The presence of a 4-chloro substituent on the phenyl ring, along with an amino group, suggests potential biological activity, possibly influencing its interaction with various receptors or enzymes. The piperazine moiety is often associated with pharmacological properties, making this compound of interest in medicinal chemistry. Its structural attributes may contribute to its solubility, stability, and reactivity, which are critical for its application in drug development or as a research chemical. Additionally, the compound's synthesis and characterization would typically involve standard organic chemistry techniques, including purification methods such as crystallization or chromatography to ensure the desired purity and yield.
Formula:C12H16ClN3O
InChI:InChI=1S/C12H16ClN3O/c1-9(17)15-4-6-16(7-5-15)12-3-2-10(13)8-11(12)14/h2-3,8H,4-7,14H2,1H3
InChI key:InChIKey=LNFNHTWMOBWCNR-UHFFFAOYSA-N
SMILES:NC1=C(C=CC(Cl)=C1)N2CCN(C(C)=O)CC2
Synonyms:
  • 1-[4-(2-Amino-4-Chlorophenyl)Piperazin-1-Yl]Ethanone
  • 1-[4-(2-Amino-4-chlorophenyl)-1-piperazinyl]ethanone
  • Ethanone, 1-[4-(2-Amino-4-Chlorophenyl)-1-Piperazinyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.