CAS 890091-80-2

2-(4-Chlorophenyl)-α-oxo-3-indolizineacetic acid

Description:

2-(4-Chlorophenyl)-α-oxo-3-indolizineacetic acid, with the CAS number 890091-80-2, is a chemical compound characterized by its unique structure, which includes an indolizine ring and a chlorophenyl group. This compound typically exhibits properties associated with both acidic and aromatic functionalities, making it potentially useful in various chemical applications. The presence of the α-oxo group suggests that it may participate in reactions typical of carbonyl compounds, such as nucleophilic additions or condensation reactions. Additionally, the chlorophenyl moiety can influence the compound's electronic properties, potentially enhancing its reactivity or biological activity. The indolizine framework is known for its diverse pharmacological properties, which may suggest that this compound could have applications in medicinal chemistry. Overall, the characteristics of this compound, including its solubility, stability, and reactivity, would depend on the specific conditions under which it is studied, such as solvent, temperature, and pH. Further research would be necessary to fully elucidate its properties and potential applications.

Formula: C₁₆H₁₀ClNO₃

InChI: InChI=1S/C16H10ClNO3/c17-11-6-4-10(5-7-11)13-9-12-3-1-2-8-18(12)14(13)15(19)16(20)21/h1-9H,(H,20,21)

InChI key: InChIKey=AFISNAKLTPIWMH-UHFFFAOYSA-N

SMILES: C(C(O)=O)(=O)C1=C(C=C2N1C=CC=C2)C3=CC=C(Cl)C=C3

Synonyms:

• 3-Indolizineacetic acid, 2-(4-chlorophenyl)-α-oxo-
• 2-(4-Chlorophenyl)-α-oxo-3-indolizineacetic acid

2-(4-Chlorophenyl)indolizine 3-Glyoxylic Acid

Controlled Product

CAS: 890091-80-2

Formula: C₁₆H₁₀ClNO₃

Color and Shape: Neat

Molecular weight: 430.88

Ref: TR-C377765