CAS 890091-81-3

1-Methyl-4-(2-methyl-2-propen-1-yl)-4-piperidinol

Description:

1-Methyl-4-(2-methyl-2-propen-1-yl)-4-piperidinol, with the CAS number 890091-81-3, is a chemical compound characterized by its piperidine structure, which includes a piperidinol moiety. This compound features a methyl group at the nitrogen atom and a propenyl substituent at the 4-position of the piperidine ring. The presence of the double bond in the propenyl group contributes to its reactivity and potential applications in organic synthesis. Typically, compounds of this nature may exhibit properties such as moderate polarity, which can influence their solubility in various solvents. Additionally, the presence of functional groups like hydroxyl and alkene can impart specific biological activities or interactions, making them of interest in medicinal chemistry. The compound's stability, reactivity, and potential applications would depend on the specific conditions under which it is used, including temperature, pH, and the presence of other reagents. Overall, 1-Methyl-4-(2-methyl-2-propen-1-yl)-4-piperidinol represents a versatile structure in organic chemistry with potential utility in various fields.

Formula: C₁₀H₁₉NO

InChI: InChI=1S/C10H19NO/c1-9(2)8-10(12)4-6-11(3)7-5-10/h12H,1,4-8H2,2-3H3

InChI key: InChIKey=NFQWKGWEOHFCAN-UHFFFAOYSA-N

SMILES: C(C(C)=C)C1(O)CCN(C)CC1

Synonyms:

• 4-Piperidinol, 1-methyl-4-(2-methyl-2-propen-1-yl)-
• 1-Methyl-4-(2-methyl-2-propen-1-yl)-4-piperidinol