CAS 890091-85-7
:2-Amino-N-butyl-6-benzothiazolesulfonamide
Description:
2-Amino-N-butyl-6-benzothiazolesulfonamide is a chemical compound characterized by its unique structure, which includes a benzothiazole moiety and a sulfonamide functional group. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of the sulfonamide group. The amino group contributes to its basicity, while the benzothiazole ring may impart specific biological activities, making it of interest in medicinal chemistry. The sulfonamide portion is known for its antibacterial properties, which could suggest potential applications in pharmaceuticals. Additionally, the butyl group enhances lipophilicity, potentially influencing the compound's pharmacokinetics. Overall, 2-Amino-N-butyl-6-benzothiazolesulfonamide represents a class of compounds that may exhibit diverse biological activities, warranting further investigation for therapeutic applications.
Formula:C11H15N3O2S2
InChI:InChI=1S/C11H15N3O2S2/c1-2-3-6-13-18(15,16)8-4-5-9-10(7-8)17-11(12)14-9/h4-5,7,13H,2-3,6H2,1H3,(H2,12,14)
InChI key:InChIKey=FIHRVOUCYJHFIM-UHFFFAOYSA-N
SMILES:S(NCCCC)(=O)(=O)C=1C=C2C(=CC1)N=C(N)S2
Synonyms:- 6-Benzothiazolesulfonamide, 2-amino-N-butyl-
- 2-Amino-N-butyl-6-benzothiazolesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.