CymitQuimica logo

CAS 890091-91-5

:

2-[(1H-Benzotriazol-6-ylamino)methyl]-6-methoxyphenol

Description:
2-[(1H-Benzotriazol-6-ylamino)methyl]-6-methoxyphenol, with the CAS number 890091-91-5, is a chemical compound characterized by its complex structure, which includes a benzotriazole moiety and a methoxyphenol group. This compound typically exhibits properties such as good solubility in organic solvents and moderate stability under standard conditions. It may possess antioxidant and UV-absorbing properties due to the presence of the benzotriazole group, which is known for its ability to stabilize free radicals and absorb ultraviolet light. The methoxyphenol component can contribute to its reactivity and potential applications in various fields, including materials science and pharmaceuticals. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Its synthesis often involves multi-step organic reactions, and it is important to handle it with care, following appropriate safety protocols, due to potential toxicity or environmental impact. Overall, this compound represents a unique intersection of organic chemistry and potential practical applications.
Formula:C14H14N4O2
InChI:InChI=1S/C14H14N4O2/c1-20-13-4-2-3-9(14(13)19)8-15-10-5-6-11-12(7-10)17-18-16-11/h2-7,15,19H,8H2,1H3,(H,16,17,18)
InChI key:InChIKey=MQHLVBJZQPALQM-UHFFFAOYSA-N
SMILES:N(CC1=C(O)C(OC)=CC=C1)C=2C=C3C(=CC2)N=NN3
Synonyms:
  • 2-[(1H-Benzotriazol-6-ylamino)methyl]-6-methoxyphenol
  • Phenol, 2-[(1H-benzotriazol-6-ylamino)methyl]-6-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.