CAS 890092-13-4

Benzoic acid, 2-[(4-cyclopentyl-1-piperazinyl)carbonyl]-

Description:

Benzoic acid, 2-[(4-cyclopentyl-1-piperazinyl)carbonyl]- is a chemical compound characterized by its structure, which includes a benzoic acid moiety and a piperazine ring substituted with a cyclopentyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. It is likely to be a solid at room temperature, with moderate solubility in organic solvents and limited solubility in water due to the presence of the hydrophobic cyclopentyl group. The piperazine component may impart certain pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the carboxylic acid functional group suggests that it can participate in acid-base reactions and may form salts or esters. Overall, this compound's unique structural features may influence its reactivity, stability, and interactions with biological targets, making it a subject of interest in various chemical and pharmaceutical research contexts.

Formula: C₁₇H₂₂N₂O₃

InChI: InChI=1S/C17H22N2O3/c20-16(14-7-3-4-8-15(14)17(21)22)19-11-9-18(10-12-19)13-5-1-2-6-13/h3-4,7-8,13H,1-2,5-6,9-12H2,(H,21,22)

InChI key: InChIKey=DFQKLKPRJMYSEY-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(C(O)=O)C=CC=C1)N2CCN(CC2)C3CCCC3

Synonyms:

• Benzoic acid, 2-[(4-cyclopentyl-1-piperazinyl)carbonyl]-
• 2-(4-Cyclopentylpiperazine-1-carbonyl)benzoic acid

2-(4-cyclopentylpiperazine-1-carbonyl)benzoic acid

CAS: 890092-13-4

Formula: C₁₇H₂₂N₂O₃

Purity: 95.0%

Molecular weight: 302.374

Ref: 10-F494891