
CAS 890092-37-2
:Benzenecarboximidamide, N-hydroxy-4-(1-piperidinylmethyl)-
Description:
Benzenecarboximidamide, N-hydroxy-4-(1-piperidinylmethyl)-, identified by CAS number 890092-37-2, is a chemical compound that features a benzenecarboximidamide structure with a hydroxyl group and a piperidinylmethyl substituent. This compound is characterized by its amide functional group, which contributes to its potential biological activity and solubility properties. The presence of the piperidine ring suggests that it may exhibit pharmacological properties, possibly interacting with biological targets such as receptors or enzymes. The hydroxyl group can enhance hydrogen bonding capabilities, influencing the compound's reactivity and solubility in polar solvents. Additionally, the aromatic benzene ring provides stability and can participate in π-π stacking interactions. Overall, this compound's unique structural features may make it of interest in medicinal chemistry and drug development, although specific applications and biological activities would require further investigation through empirical studies.
Formula:C13H19N3O
InChI:InChI=1S/C13H19N3O/c14-13(15-17)12-6-4-11(5-7-12)10-16-8-2-1-3-9-16/h4-7,17H,1-3,8-10H2,(H2,14,15)
InChI key:InChIKey=IMKYXWQLXCGGAQ-UHFFFAOYSA-N
SMILES:C(C1=CC=C(C(NO)=N)C=C1)N2CCCCC2
Synonyms:- Benzenecarboximidamide N′-hydroxy-4-(1-piperidinylmethyl)-
- Benzenecarboximidamide, N-hydroxy-4-(1-piperidinylmethyl)-
- N′-Hydroxy-4-(piperidin-1-ylmethyl)benzenecarboximidamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.