
CAS 890092-99-6
:4-(2H-Tetrazol-5-yl)-1,2,5-oxadiazole-3-carboximidic acid hydrazide
Description:
4-(2H-Tetrazol-5-yl)-1,2,5-oxadiazole-3-carboximidic acid hydrazide is a chemical compound characterized by its complex structure, which includes a tetrazole ring and an oxadiazole moiety. This compound is known for its potential biological activity, particularly in the field of medicinal chemistry, where it may exhibit properties such as antimicrobial or anti-inflammatory effects. The presence of the hydrazide functional group suggests that it may participate in various chemical reactions, including hydrazone formation and potential interactions with biological targets. Its solubility and stability can vary depending on the solvent and environmental conditions, which are important factors for its application in research and development. Additionally, the compound's molecular interactions and reactivity can be influenced by the presence of functional groups, making it a subject of interest for further studies in drug design and synthesis. Overall, this compound represents a unique scaffold that may contribute to the development of new therapeutic agents.
Formula:C4H5N9O
InChI:InChI=1S/C4H5N9O/c5-3(7-6)1-2(11-14-10-1)4-8-12-13-9-4/h6H2,(H2,5,7)(H,8,9,12,13)
InChI key:InChIKey=XXAHCAHWKKDUOL-UHFFFAOYSA-N
SMILES:C(NN)(=N)C=1C(=NON1)C=2NN=NN2
Synonyms:- 1,2,5-Oxadiazole-3-carboximidic acid, 4-(2H-tetrazol-5-yl)-, hydrazide
- 4-(2H-Tetrazol-5-yl)-1,2,5-oxadiazole-3-carboximidic acid hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.