
CAS 890093-08-0
:α-(4-Methoxy-4-methylpentyl)-3-(4-methoxyphenyl)-α-methyl-5-isoxazolemethanol
Description:
α-(4-Methoxy-4-methylpentyl)-3-(4-methoxyphenyl)-α-methyl-5-isoxazolemethanol, with the CAS number 890093-08-0, is a synthetic organic compound characterized by its complex molecular structure, which includes an isoxazole ring and multiple methoxy and methyl substituents. This compound is typically classified as a psychoactive substance and may exhibit properties that influence the central nervous system. Its structure suggests potential interactions with neurotransmitter systems, although specific pharmacological effects can vary. The presence of methoxy groups often enhances lipophilicity, potentially affecting its bioavailability and distribution in biological systems. Additionally, the isoxazole moiety may contribute to its reactivity and stability under various conditions. As with many synthetic compounds, understanding its safety profile, including toxicity and potential for abuse, is crucial for its evaluation in both research and therapeutic contexts. Overall, this compound represents a class of substances that may have significant implications in medicinal chemistry and pharmacology.
Formula:C19H27NO4
InChI:InChI=1S/C19H27NO4/c1-18(2,23-5)11-6-12-19(3,21)17-13-16(20-24-17)14-7-9-15(22-4)10-8-14/h7-10,13,21H,6,11-12H2,1-5H3
InChI key:InChIKey=NQXHWNVRVJRDKU-UHFFFAOYSA-N
SMILES:C(CCCC(OC)(C)C)(C)(O)C1=CC(=NO1)C2=CC=C(OC)C=C2
Synonyms:- α-(4-Methoxy-4-methylpentyl)-3-(4-methoxyphenyl)-α-methyl-5-isoxazolemethanol
- 5-Isoxazolemethanol, α-(4-methoxy-4-methylpentyl)-3-(4-methoxyphenyl)-α-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.