
CAS 890093-95-5
:4-[5-(4-Pyridinyl)-1H-1,2,3-triazol-1-yl]-1,2,5-oxadiazol-3-amine
Description:
4-[5-(4-Pyridinyl)-1H-1,2,3-triazol-1-yl]-1,2,5-oxadiazol-3-amine is a chemical compound characterized by its complex structure, which includes a pyridine ring, a triazole moiety, and an oxadiazole functional group. This compound typically exhibits properties such as being a solid at room temperature, with potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its bioactive components. The presence of the triazole and oxadiazole rings suggests potential for diverse interactions with biological targets, making it of interest in drug discovery. Additionally, the compound may display solubility in various organic solvents, which is important for its application in synthesis and formulation. Its molecular structure allows for various functionalization possibilities, enhancing its versatility in chemical reactions. Overall, this compound represents a class of heterocyclic compounds that are significant in the field of organic chemistry and medicinal applications.
Formula:C9H7N7O
InChI:InChI=1S/C9H7N7O/c10-8-9(14-17-13-8)16-7(5-12-15-16)6-1-3-11-4-2-6/h1-5H,(H2,10,13)
InChI key:InChIKey=BQCQGONFENYAHH-UHFFFAOYSA-N
SMILES:NC=1C(N2C(=CN=N2)C=3C=CN=CC3)=NON1
Synonyms:- 1,2,5-Oxadiazol-3-amine, 4-[5-(4-pyridinyl)-1H-1,2,3-triazol-1-yl]-
- 4-[5-(4-Pyridinyl)-1H-1,2,3-triazol-1-yl]-1,2,5-oxadiazol-3-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.