CAS 890094-61-8

1-[(4-Chlorophenyl)methyl]-α-oxo-1H-indole-3-acetic acid

Description:

1-[(4-Chlorophenyl)methyl]-α-oxo-1H-indole-3-acetic acid, with the CAS number 890094-61-8, is a synthetic compound that belongs to the class of indole derivatives. This substance features a distinctive indole structure, which is a bicyclic compound consisting of a six-membered benzene ring fused to a five-membered nitrogen-containing pyrrole ring. The presence of a 4-chlorobenzyl group enhances its lipophilicity and may influence its biological activity. The α-oxo group contributes to its reactivity, potentially allowing for various chemical transformations. This compound is of interest in medicinal chemistry due to its potential pharmacological properties, which may include anti-inflammatory or analgesic effects. Its structural characteristics suggest that it could interact with biological targets, making it a candidate for further research in drug development. As with many chemical substances, safety and handling precautions are essential, and its use should be guided by appropriate regulatory standards.

Formula: C₁₇H₁₂ClNO₃

InChI: InChI=1S/C17H12ClNO3/c18-12-7-5-11(6-8-12)9-19-10-14(16(20)17(21)22)13-3-1-2-4-15(13)19/h1-8,10H,9H2,(H,21,22)

InChI key: InChIKey=YMYZWUQHVWWZKI-UHFFFAOYSA-N

SMILES: C(N1C=2C(C(C(C(O)=O)=O)=C1)=CC=CC2)C3=CC=C(Cl)C=C3

Synonyms:

• 1H-Indole-3-acetic acid, 1-[(4-chlorophenyl)methyl]-α-oxo-
• 1-[(4-Chlorophenyl)methyl]-α-oxo-1H-indole-3-acetic acid