CymitQuimica logo

CAS 890095-47-3

:

1,2,4-Oxadiazole-5-methanol, 3-(4-amino-1,2,5-oxadiazol-3-yl)-

Description:
1,2,4-Oxadiazole-5-methanol, 3-(4-amino-1,2,5-oxadiazol-3-yl)- is a chemical compound characterized by its oxadiazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms and three carbon atoms. This compound features a hydroxymethyl group (-CH2OH) at the 5-position of the oxadiazole ring, contributing to its potential reactivity and solubility in polar solvents. The presence of an amino group (-NH2) at the 3-position of a substituted oxadiazole enhances its biological activity, making it of interest in medicinal chemistry and pharmaceuticals. The compound may exhibit various properties, including potential antimicrobial or antitumor activities, due to the structural motifs that are often associated with bioactive compounds. Its molecular interactions, stability, and reactivity can be influenced by the functional groups present, making it a subject of study for applications in drug development and material science. As with many heterocycles, the specific characteristics can vary based on the substituents and the overall molecular environment.
Formula:C5H5N5O3
InChI:InChI=1S/C5H5N5O3/c6-4-3(8-13-9-4)5-7-2(1-11)12-10-5/h11H,1H2,(H2,6,9)
InChI key:InChIKey=PWDCSHZTLOWLFI-UHFFFAOYSA-N
SMILES:NC=1C(=NON1)C=2N=C(CO)ON2
Synonyms:
  • 1,2,4-Oxadiazole-5-methanol, 3-(4-amino-1,2,5-oxadiazol-3-yl)-
  • [3-(4-Amino-1,2,5-oxadiazol-3-yl)-1,2,4-oxadiazol-5-yl]methanol
  • [3-(4-Amino-1,2,5-oxadiazol-3-yl)-1,2,4-oxadiazol-5-yl]methan-1-ol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.