CymitQuimica logo

CAS 890095-49-5

:

5-Amino-1,7-dihydro-7-(3-pyridinyl)[1,2,4]triazolo[1,5-a]pyrimidine-6-carbonitrile

Description:
5-Amino-1,7-dihydro-7-(3-pyridinyl)[1,2,4]triazolo[1,5-a]pyrimidine-6-carbonitrile is a heterocyclic compound characterized by its complex structure, which includes a triazole and pyrimidine ring system. This compound features an amino group and a carbonitrile functional group, contributing to its potential reactivity and biological activity. The presence of the pyridine moiety suggests possible interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure allows for various hydrogen bonding and electronic interactions, which can influence its solubility and stability. The compound is typically synthesized through multi-step organic reactions, and its properties may include moderate to high polarity, depending on the substituents and their positions. As with many heterocycles, it may exhibit pharmacological properties, potentially acting as an inhibitor or modulator in biological systems. Safety and handling precautions should be observed, as with any chemical substance, particularly in research and development contexts.
Formula:C11H9N7
InChI:InChI=1S/C11H9N7/c12-4-8-9(7-2-1-3-14-5-7)18-11(15-6-16-18)17-10(8)13/h1-3,5-6,9H,13H2,(H,15,16,17)
InChI key:InChIKey=BHTBTFWOJNGQIP-UHFFFAOYSA-N
SMILES:C(#N)C=1C(N2C(=NC1N)NC=N2)C=3C=CC=NC3
Synonyms:
  • 5-Amino-1,7-dihydro-7-(3-pyridinyl)[1,2,4]triazolo[1,5-a]pyrimidine-6-carbonitrile
  • [1,2,4]Triazolo[1,5-a]pyrimidine-6-carbonitrile, 5-amino-1,7-dihydro-7-(3-pyridinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.