CAS 890095-53-1

3-(2-Aminophenyl)-1H-1,2,4-triazol-5-amine

Description:

3-(2-Aminophenyl)-1H-1,2,4-triazol-5-amine is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features an amino group and a phenyl group, contributing to its potential biological activity. The presence of the amino group suggests that it may participate in hydrogen bonding, enhancing its solubility in polar solvents. The compound's structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as triazole derivatives are known for their antifungal and anticancer properties. Additionally, the compound may exhibit various reactivity patterns due to the functional groups present, making it a candidate for further chemical modifications. Its CAS number, 890095-53-1, allows for easy identification and retrieval of information regarding its properties, safety data, and potential applications in scientific literature and databases. Overall, this compound represents a significant interest in both synthetic and medicinal chemistry fields.

Formula: C₈H₉N₅

InChI: InChI=1S/C8H9N5/c9-6-4-2-1-3-5(6)7-11-8(10)13-12-7/h1-4H,9H2,(H3,10,11,12,13)

InChI key: InChIKey=JGJLWSWBDUXSHI-UHFFFAOYSA-N

SMILES: NC1=C(C=CC=C1)C=2NC(N)=NN2

Synonyms:

• 3-(2-Aminophenyl)-1H-1,2,4-triazol-5-amine
• 1H-1,2,4-Triazol-5-amine, 3-(2-aminophenyl)-